C21H17Cl2NO3 — CID 95733655
N-[4-chloro-2-[(R)-hydroxy(phenyl)methyl]phenyl]-2-(2-chlorophenoxy)acetamide (PubChem CID 95733655) has the molecular formula C21H17Cl2NO3 and a molecular weight of 402.28 g/mol. Its IUPAC name is N-[4-chloro-2-[(R)-hydroxy(phenyl)methyl]phenyl]-2-(2-chlorophenoxy)acetamide.
| Compound Name | N-[4-chloro-2-[(R)-hydroxy(phenyl)methyl]phenyl]-2-(2-chlorophenoxy)acetamide |
|---|---|
| PubChem CID | 95733655 |
| Molecular Formula | C21H17Cl2NO3 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | N-[4-chloro-2-[(R)-hydroxy(phenyl)methyl]phenyl]-2-(2-chlorophenoxy)acetamide |
| SMILES | O=C(COc1ccccc1Cl)Nc1ccc(Cl)cc1[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C21H17Cl2NO3/c22-15-10-11-18(16(12-15)21(26)14-6-2-1-3-7-14)24-20(25)13-27-19-9-5-4-8-17(19)23/h1-12,21,26H,13H2,(H,24,25)/t21-/m1/s1 |
| InChIKey | YIRKRWWFZPGGFJ-OAQYLSRUSA-N |
| XLogP | 5.09 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |