C27H22ClNO3 — CID 95733672
N-[4-chloro-2-[(R)-hydroxy(phenyl)methyl]phenyl]-2-(4-phenylphenoxy)acetamide (PubChem CID 95733672) has the molecular formula C27H22ClNO3 and a molecular weight of 443.93 g/mol. Its IUPAC name is N-[4-chloro-2-[(R)-hydroxy(phenyl)methyl]phenyl]-2-(4-phenylphenoxy)acetamide.
| Compound Name | N-[4-chloro-2-[(R)-hydroxy(phenyl)methyl]phenyl]-2-(4-phenylphenoxy)acetamide |
|---|---|
| PubChem CID | 95733672 |
| Molecular Formula | C27H22ClNO3 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | N-[4-chloro-2-[(R)-hydroxy(phenyl)methyl]phenyl]-2-(4-phenylphenoxy)acetamide |
| SMILES | O=C(COc1ccc(-c2ccccc2)cc1)Nc1ccc(Cl)cc1[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C27H22ClNO3/c28-22-13-16-25(24(17-22)27(31)21-9-5-2-6-10-21)29-26(30)18-32-23-14-11-20(12-15-23)19-7-3-1-4-8-19/h1-17,27,31H,18H2,(H,29,30)/t27-/m1/s1 |
| InChIKey | KBAOWCPUHIXXOU-HHHXNRCGSA-N |
| XLogP | 6.11 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |