C17H26N2O2 — CID 95735480
[(3R,8aR)-2-[(4-methoxyphenyl)methyl]-8a-methyl-1,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methanol (PubChem CID 95735480) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is [(3R,8aR)-2-[(4-methoxyphenyl)methyl]-8a-methyl-1,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methanol.
| Compound Name | [(3R,8aR)-2-[(4-methoxyphenyl)methyl]-8a-methyl-1,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methanol |
|---|---|
| PubChem CID | 95735480 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | [(3R,8aR)-2-[(4-methoxyphenyl)methyl]-8a-methyl-1,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methanol |
| SMILES | COc1ccc(CN2C[C@@]3(C)CCCN3C[C@@H]2CO)cc1 |
| InChI | InChI=1S/C17H26N2O2/c1-17-8-3-9-19(17)11-15(12-20)18(13-17)10-14-4-6-16(21-2)7-5-14/h4-7,15,20H,3,8-13H2,1-2H3/t15-,17-/m1/s1 |
| InChIKey | ZUGGYBZWAOHVJU-NVXWUHKLSA-N |
| XLogP | 1.73 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |