C18H17FN2O3 — CID 95738065
(2R,3S)-N-(3-fluorophenyl)-4-methyl-5-oxo-3-phenylmorpholine-2-carboxamide (PubChem CID 95738065) has the molecular formula C18H17FN2O3 and a molecular weight of 328.34 g/mol. Its IUPAC name is (2R,3S)-N-(3-fluorophenyl)-4-methyl-5-oxo-3-phenylmorpholine-2-carboxamide.
| Compound Name | (2R,3S)-N-(3-fluorophenyl)-4-methyl-5-oxo-3-phenylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 95738065 |
| Molecular Formula | C18H17FN2O3 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (2R,3S)-N-(3-fluorophenyl)-4-methyl-5-oxo-3-phenylmorpholine-2-carboxamide |
| SMILES | CN1C(=O)CO[C@@H](C(=O)Nc2cccc(F)c2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H17FN2O3/c1-21-15(22)11-24-17(16(21)12-6-3-2-4-7-12)18(23)20-14-9-5-8-13(19)10-14/h2-10,16-17H,11H2,1H3,(H,20,23)/t16-,17+/m0/s1 |
| InChIKey | VNROFVJLPCNPCZ-DLBZAZTESA-N |
| XLogP | 2.36 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |