C24H20N4O3 — CID 95738661
N-[(1R)-2-(benzylamino)-2-oxo-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]benzamide (PubChem CID 95738661) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is N-[(1R)-2-(benzylamino)-2-oxo-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]benzamide.
| Compound Name | N-[(1R)-2-(benzylamino)-2-oxo-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 95738661 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N-[(1R)-2-(benzylamino)-2-oxo-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]benzamide |
| SMILES | O=C(N[C@@H](C(=O)NCc1ccccc1)c1nnc(-c2ccccc2)o1)c1ccccc1 |
| InChI | InChI=1S/C24H20N4O3/c29-21(18-12-6-2-7-13-18)26-20(22(30)25-16-17-10-4-1-5-11-17)24-28-27-23(31-24)19-14-8-3-9-15-19/h1-15,20H,16H2,(H,25,30)(H,26,29)/t20-/m0/s1 |
| InChIKey | RZWJKSNQHNZFGN-FQEVSTJZSA-N |
| XLogP | 3.52 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |