C22H17BrN2O4 — CID 95744847
5-[(2-bromophenoxy)methyl]-N-(7-methoxyquinolin-3-yl)furan-2-carboxamide (PubChem CID 95744847) has the molecular formula C22H17BrN2O4 and a molecular weight of 453.29 g/mol. Its IUPAC name is 5-[(2-bromophenoxy)methyl]-N-(7-methoxyquinolin-3-yl)furan-2-carboxamide.
| Compound Name | 5-[(2-bromophenoxy)methyl]-N-(7-methoxyquinolin-3-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 95744847 |
| Molecular Formula | C22H17BrN2O4 |
| Molecular Weight | 453.29 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 5-[(2-bromophenoxy)methyl]-N-(7-methoxyquinolin-3-yl)furan-2-carboxamide |
| SMILES | COc1ccc2cc(NC(=O)c3ccc(COc4ccccc4Br)o3)cnc2c1 |
| InChI | InChI=1S/C22H17BrN2O4/c1-27-16-7-6-14-10-15(12-24-19(14)11-16)25-22(26)21-9-8-17(29-21)13-28-20-5-3-2-4-18(20)23/h2-12H,13H2,1H3,(H,25,26) |
| InChIKey | YBMSPERUZGFDOY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.29 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |