C14H10F5N3O3 — CID 95749126
methyl 1,3-dimethyl-4-[(2,3,4,5,6-pentafluorobenzoyl)amino]pyrazole-5-carboxylate (PubChem CID 95749126) has the molecular formula C14H10F5N3O3 and a molecular weight of 363.24 g/mol. Its IUPAC name is methyl 1,3-dimethyl-4-[(2,3,4,5,6-pentafluorobenzoyl)amino]pyrazole-5-carboxylate.
| Compound Name | methyl 1,3-dimethyl-4-[(2,3,4,5,6-pentafluorobenzoyl)amino]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 95749126 |
| Molecular Formula | C14H10F5N3O3 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | methyl 1,3-dimethyl-4-[(2,3,4,5,6-pentafluorobenzoyl)amino]pyrazole-5-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2c(F)c(F)c(F)c(F)c2F)c(C)nn1C |
| InChI | InChI=1S/C14H10F5N3O3/c1-4-11(12(14(24)25-3)22(2)21-4)20-13(23)5-6(15)8(17)10(19)9(18)7(5)16/h1-3H3,(H,20,23) |
| InChIKey | JWMSYBWTAVHNNA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|