C14H14IN3O3 — CID 95749120
methyl 4-[(2-iodobenzoyl)amino]-1,3-dimethylpyrazole-5-carboxylate (PubChem CID 95749120) has the molecular formula C14H14IN3O3 and a molecular weight of 399.19 g/mol. Its IUPAC name is methyl 4-[(2-iodobenzoyl)amino]-1,3-dimethylpyrazole-5-carboxylate.
| Compound Name | methyl 4-[(2-iodobenzoyl)amino]-1,3-dimethylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 95749120 |
| Molecular Formula | C14H14IN3O3 |
| Molecular Weight | 399.19 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | methyl 4-[(2-iodobenzoyl)amino]-1,3-dimethylpyrazole-5-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2ccccc2I)c(C)nn1C |
| InChI | InChI=1S/C14H14IN3O3/c1-8-11(12(14(20)21-3)18(2)17-8)16-13(19)9-6-4-5-7-10(9)15/h4-7H,1-3H3,(H,16,19) |
| InChIKey | XMIWRYFZKIUXFZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.19 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|