methyl 4-iodo-1,3-dimethylpyrazole-5-carboxylate

C7H9IN2O2 — CID 130141047

IUPACmethyl 4-iodo-1,3-dimethylpyrazole-5-carboxylate
SMILESCOC(=O)c1c(I)c(C)nn1C
InChIInChI=1S/C7H9IN2O2/c1-4-5(8)6(7(11)12-3)10(2)9-4/h1-3H3
InChIKeyCCXMXHUJAJUPQL-UHFFFAOYSA-N
MW280.06 g/mol
LogP1.12
Rot. Bonds1

About methyl 4-iodo-1,3-dimethylpyrazole-5-carboxylate

methyl 4-iodo-1,3-dimethylpyrazole-5-carboxylate (PubChem CID 130141047) has the molecular formula C7H9IN2O2 and a molecular weight of 280.06 g/mol. Its IUPAC name is methyl 4-iodo-1,3-dimethylpyrazole-5-carboxylate.

Molecular Properties

Compound Namemethyl 4-iodo-1,3-dimethylpyrazole-5-carboxylate
PubChem CID130141047
Molecular FormulaC7H9IN2O2
Molecular Weight280.06 g/mol
Exact Mass279.97
IUPAC Namemethyl 4-iodo-1,3-dimethylpyrazole-5-carboxylate
SMILESCOC(=O)c1c(I)c(C)nn1C
InChIInChI=1S/C7H9IN2O2/c1-4-5(8)6(7(11)12-3)10(2)9-4/h1-3H3
InChIKeyCCXMXHUJAJUPQL-UHFFFAOYSA-N
XLogP1.12
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.06
LogP ≤ 51.12
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze methyl 4-iodo-1,3-dimethylpyrazole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-iodo-1,3-dimethylpyrazole-5-carboxylate?
The IUPAC name of methyl 4-iodo-1,3-dimethylpyrazole-5-carboxylate (CID 130141047) is methyl 4-iodo-1,3-dimethylpyrazole-5-carboxylate.
What is the SMILES notation for methyl 4-iodo-1,3-dimethylpyrazole-5-carboxylate?
The canonical SMILES for methyl 4-iodo-1,3-dimethylpyrazole-5-carboxylate is COC(=O)c1c(I)c(C)nn1C.
What is the InChIKey of methyl 4-iodo-1,3-dimethylpyrazole-5-carboxylate?
The InChIKey is CCXMXHUJAJUPQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9IN2O2/c1-4-5(8)6(7(11)12-3)10(2)9-4/h1-3H3.
What are the key properties of methyl 4-iodo-1,3-dimethylpyrazole-5-carboxylate?
methyl 4-iodo-1,3-dimethylpyrazole-5-carboxylate has a molecular weight of 280.06 g/mol, XLogP of 1.12, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-iodo-1,3-dimethylpyrazole-5-carboxylate is sourced from PubChem (CID 130141047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).