C7H9IN2O2 — CID 130141047
methyl 4-iodo-1,3-dimethylpyrazole-5-carboxylate (PubChem CID 130141047) has the molecular formula C7H9IN2O2 and a molecular weight of 280.06 g/mol. Its IUPAC name is methyl 4-iodo-1,3-dimethylpyrazole-5-carboxylate.
| Compound Name | methyl 4-iodo-1,3-dimethylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 130141047 |
| Molecular Formula | C7H9IN2O2 |
| Molecular Weight | 280.06 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | methyl 4-iodo-1,3-dimethylpyrazole-5-carboxylate |
| SMILES | COC(=O)c1c(I)c(C)nn1C |
| InChI | InChI=1S/C7H9IN2O2/c1-4-5(8)6(7(11)12-3)10(2)9-4/h1-3H3 |
| InChIKey | CCXMXHUJAJUPQL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.06 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|