C17H20FN3O2 — CID 95751988
N'-(3-cyano-4-fluorophenyl)-N-[[(1S,3R)-3-methylcyclohexyl]methyl]oxamide (PubChem CID 95751988) has the molecular formula C17H20FN3O2 and a molecular weight of 317.36 g/mol. Its IUPAC name is N'-(3-cyano-4-fluorophenyl)-N-[[(1S,3R)-3-methylcyclohexyl]methyl]oxamide.
| Compound Name | N'-(3-cyano-4-fluorophenyl)-N-[[(1S,3R)-3-methylcyclohexyl]methyl]oxamide |
|---|---|
| PubChem CID | 95751988 |
| Molecular Formula | C17H20FN3O2 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | N'-(3-cyano-4-fluorophenyl)-N-[[(1S,3R)-3-methylcyclohexyl]methyl]oxamide |
| SMILES | C[C@@H]1CCC[C@H](CNC(=O)C(=O)Nc2ccc(F)c(C#N)c2)C1 |
| InChI | InChI=1S/C17H20FN3O2/c1-11-3-2-4-12(7-11)10-20-16(22)17(23)21-14-5-6-15(18)13(8-14)9-19/h5-6,8,11-12H,2-4,7,10H2,1H3,(H,20,22)(H,21,23)/t11-,12+/m1/s1 |
| InChIKey | VVQQNOANTMTFGN-NEPJUHHUSA-N |
| XLogP | 2.58 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|