C21H31NO5 — CID 95769595
methyl 3-[[2-[4-(2-methylpropoxy)phenyl]acetyl]-[[(2R)-oxolan-2-yl]methyl]amino]propanoate (PubChem CID 95769595) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is methyl 3-[[2-[4-(2-methylpropoxy)phenyl]acetyl]-[[(2R)-oxolan-2-yl]methyl]amino]propanoate.
| Compound Name | methyl 3-[[2-[4-(2-methylpropoxy)phenyl]acetyl]-[[(2R)-oxolan-2-yl]methyl]amino]propanoate |
|---|---|
| PubChem CID | 95769595 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | methyl 3-[[2-[4-(2-methylpropoxy)phenyl]acetyl]-[[(2R)-oxolan-2-yl]methyl]amino]propanoate |
| SMILES | COC(=O)CCN(C[C@H]1CCCO1)C(=O)Cc1ccc(OCC(C)C)cc1 |
| InChI | InChI=1S/C21H31NO5/c1-16(2)15-27-18-8-6-17(7-9-18)13-20(23)22(11-10-21(24)25-3)14-19-5-4-12-26-19/h6-9,16,19H,4-5,10-15H2,1-3H3/t19-/m1/s1 |
| InChIKey | SWFRIPCFDWVEDB-LJQANCHMSA-N |
| XLogP | 2.83 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |