C16H22N4OS — CID 95773118
4-methyl-N-[(2R)-2-[(2R)-2-methylmorpholin-4-yl]-2-thiophen-2-ylethyl]pyrimidin-2-amine (PubChem CID 95773118) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is 4-methyl-N-[(2R)-2-[(2R)-2-methylmorpholin-4-yl]-2-thiophen-2-ylethyl]pyrimidin-2-amine.
| Compound Name | 4-methyl-N-[(2R)-2-[(2R)-2-methylmorpholin-4-yl]-2-thiophen-2-ylethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 95773118 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 4-methyl-N-[(2R)-2-[(2R)-2-methylmorpholin-4-yl]-2-thiophen-2-ylethyl]pyrimidin-2-amine |
| SMILES | Cc1ccnc(NC[C@H](c2cccs2)N2CCO[C@H](C)C2)n1 |
| InChI | InChI=1S/C16H22N4OS/c1-12-5-6-17-16(19-12)18-10-14(15-4-3-9-22-15)20-7-8-21-13(2)11-20/h3-6,9,13-14H,7-8,10-11H2,1-2H3,(H,17,18,19)/t13-,14-/m1/s1 |
| InChIKey | PHYHLVFNJZGJMF-ZIAGYGMSSA-N |
| XLogP | 2.72 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |