C17H25N5O3S — CID 133441446
3-ethyl-1-methyl-N-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]-4-nitropyrazol-5-amine (PubChem CID 133441446) has the molecular formula C17H25N5O3S and a molecular weight of 379.49 g/mol. Its IUPAC name is 3-ethyl-1-methyl-N-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]-4-nitropyrazol-5-amine.
| Compound Name | 3-ethyl-1-methyl-N-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]-4-nitropyrazol-5-amine |
|---|---|
| PubChem CID | 133441446 |
| Molecular Formula | C17H25N5O3S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 3-ethyl-1-methyl-N-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]-4-nitropyrazol-5-amine |
| SMILES | CCc1nn(C)c(NCC(c2cccs2)N2CCOC(C)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H25N5O3S/c1-4-13-16(22(23)24)17(20(3)19-13)18-10-14(15-6-5-9-26-15)21-7-8-25-12(2)11-21/h5-6,9,12,14,18H,4,7-8,10-11H2,1-3H3 |
| InChIKey | FLXOXIDFNFANLA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|