C19H27N3O3 — CID 95773561
N-[(2R,3R)-2-hydroxy-3-methylpentyl]-N'-(1-propylindol-5-yl)oxamide (PubChem CID 95773561) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is N-[(2R,3R)-2-hydroxy-3-methylpentyl]-N'-(1-propylindol-5-yl)oxamide.
| Compound Name | N-[(2R,3R)-2-hydroxy-3-methylpentyl]-N'-(1-propylindol-5-yl)oxamide |
|---|---|
| PubChem CID | 95773561 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-[(2R,3R)-2-hydroxy-3-methylpentyl]-N'-(1-propylindol-5-yl)oxamide |
| SMILES | CCCn1ccc2cc(NC(=O)C(=O)NC[C@H](O)[C@H](C)CC)ccc21 |
| InChI | InChI=1S/C19H27N3O3/c1-4-9-22-10-8-14-11-15(6-7-16(14)22)21-19(25)18(24)20-12-17(23)13(3)5-2/h6-8,10-11,13,17,23H,4-5,9,12H2,1-3H3,(H,20,24)(H,21,25)/t13-,17+/m1/s1 |
| InChIKey | GXUKSZUONNKBDJ-DYVFJYSZSA-N |
| XLogP | 2.51 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|