C16H11ClF2N4O — CID 95776041
(2S)-2-(4-chlorophenyl)-2-[(6,7-difluoroquinoxalin-2-yl)amino]acetamide (PubChem CID 95776041) has the molecular formula C16H11ClF2N4O and a molecular weight of 348.74 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)-2-[(6,7-difluoroquinoxalin-2-yl)amino]acetamide.
| Compound Name | (2S)-2-(4-chlorophenyl)-2-[(6,7-difluoroquinoxalin-2-yl)amino]acetamide |
|---|---|
| PubChem CID | 95776041 |
| Molecular Formula | C16H11ClF2N4O |
| Molecular Weight | 348.74 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)-2-[(6,7-difluoroquinoxalin-2-yl)amino]acetamide |
| SMILES | NC(=O)[C@@H](Nc1cnc2cc(F)c(F)cc2n1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H11ClF2N4O/c17-9-3-1-8(2-4-9)15(16(20)24)23-14-7-21-12-5-10(18)11(19)6-13(12)22-14/h1-7,15H,(H2,20,24)(H,22,23)/t15-/m0/s1 |
| InChIKey | MIQBUPJIIGIBJR-HNNXBMFYSA-N |
| XLogP | 3.20 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.74 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |