C16H22N4O2 — CID 95776370
3-[(2S)-butan-2-yl]-N-[(6S)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-1,2-oxazole-5-carboxamide (PubChem CID 95776370) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 3-[(2S)-butan-2-yl]-N-[(6S)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-1,2-oxazole-5-carboxamide.
| Compound Name | 3-[(2S)-butan-2-yl]-N-[(6S)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 95776370 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 3-[(2S)-butan-2-yl]-N-[(6S)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-1,2-oxazole-5-carboxamide |
| SMILES | CC[C@H](C)c1cc(C(=O)N[C@H]2CCc3nc(C)cn3C2)on1 |
| InChI | InChI=1S/C16H22N4O2/c1-4-10(2)13-7-14(22-19-13)16(21)18-12-5-6-15-17-11(3)8-20(15)9-12/h7-8,10,12H,4-6,9H2,1-3H3,(H,18,21)/t10-,12-/m0/s1 |
| InChIKey | YDNBOHRFHTWAJB-JQWIXIFHSA-N |
| XLogP | 2.44 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |