C19H19N3O2 — CID 95777230
N-[[(2R)-oxolan-2-yl]methyl]-N-pyridin-4-ylindolizine-2-carboxamide (PubChem CID 95777230) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is N-[[(2R)-oxolan-2-yl]methyl]-N-pyridin-4-ylindolizine-2-carboxamide.
| Compound Name | N-[[(2R)-oxolan-2-yl]methyl]-N-pyridin-4-ylindolizine-2-carboxamide |
|---|---|
| PubChem CID | 95777230 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-[[(2R)-oxolan-2-yl]methyl]-N-pyridin-4-ylindolizine-2-carboxamide |
| SMILES | O=C(c1cc2ccccn2c1)N(C[C@H]1CCCO1)c1ccncc1 |
| InChI | InChI=1S/C19H19N3O2/c23-19(15-12-17-4-1-2-10-21(17)13-15)22(14-18-5-3-11-24-18)16-6-8-20-9-7-16/h1-2,4,6-10,12-13,18H,3,5,11,14H2/t18-/m1/s1 |
| InChIKey | VGJBIPOATGGRGE-GOSISDBHSA-N |
| XLogP | 3.16 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |