C18H19N3O4 — CID 96547608
2-methyl-5-nitro-N-[[(2R)-oxolan-2-yl]methyl]-N-pyridin-4-ylbenzamide (PubChem CID 96547608) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 2-methyl-5-nitro-N-[[(2R)-oxolan-2-yl]methyl]-N-pyridin-4-ylbenzamide.
| Compound Name | 2-methyl-5-nitro-N-[[(2R)-oxolan-2-yl]methyl]-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 96547608 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-methyl-5-nitro-N-[[(2R)-oxolan-2-yl]methyl]-N-pyridin-4-ylbenzamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1C(=O)N(C[C@H]1CCCO1)c1ccncc1 |
| InChI | InChI=1S/C18H19N3O4/c1-13-4-5-15(21(23)24)11-17(13)18(22)20(12-16-3-2-10-25-16)14-6-8-19-9-7-14/h4-9,11,16H,2-3,10,12H2,1H3/t16-/m1/s1 |
| InChIKey | XBPUMODRQDDUEG-MRXNPFEDSA-N |
| XLogP | 3.12 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|