C18H23N5O — CID 95779878
(3S)-1-phenyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)piperidin-2-one (PubChem CID 95779878) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is (3S)-1-phenyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)piperidin-2-one.
| Compound Name | (3S)-1-phenyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)piperidin-2-one |
|---|---|
| PubChem CID | 95779878 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | (3S)-1-phenyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylamino)piperidin-2-one |
| SMILES | O=C1[C@@H](NCc2nnc3n2CCCC3)CCCN1c1ccccc1 |
| InChI | InChI=1S/C18H23N5O/c24-18-15(9-6-12-22(18)14-7-2-1-3-8-14)19-13-17-21-20-16-10-4-5-11-23(16)17/h1-3,7-8,15,19H,4-6,9-13H2/t15-/m0/s1 |
| InChIKey | QYFZGOWMKHCWKJ-HNNXBMFYSA-N |
| XLogP | 1.90 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |