C24H32FN3O2S — CID 95788925
1-[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-1-(2-methylpropyl)-3-(2-methyl-4-thiomorpholin-4-ylphenyl)urea (PubChem CID 95788925) has the molecular formula C24H32FN3O2S and a molecular weight of 445.60 g/mol. Its IUPAC name is 1-[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-1-(2-methylpropyl)-3-(2-methyl-4-thiomorpholin-4-ylphenyl)urea.
| Compound Name | 1-[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-1-(2-methylpropyl)-3-(2-methyl-4-thiomorpholin-4-ylphenyl)urea |
|---|---|
| PubChem CID | 95788925 |
| Molecular Formula | C24H32FN3O2S |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 1-[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-1-(2-methylpropyl)-3-(2-methyl-4-thiomorpholin-4-ylphenyl)urea |
| SMILES | Cc1cc(N2CCSCC2)ccc1NC(=O)N(CC(C)C)C[C@@H](O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H32FN3O2S/c1-17(2)15-28(16-23(29)19-4-6-20(25)7-5-19)24(30)26-22-9-8-21(14-18(22)3)27-10-12-31-13-11-27/h4-9,14,17,23,29H,10-13,15-16H2,1-3H3,(H,26,30)/t23-/m1/s1 |
| InChIKey | MKWBLQYWZHCWDK-HSZRJFAPSA-N |
| XLogP | 4.91 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|