C19H21N3O3S — CID 49471359
1-(1,3-benzodioxol-5-yl)-3-(2-methyl-4-thiomorpholin-4-ylphenyl)urea (PubChem CID 49471359) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(2-methyl-4-thiomorpholin-4-ylphenyl)urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(2-methyl-4-thiomorpholin-4-ylphenyl)urea |
|---|---|
| PubChem CID | 49471359 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(2-methyl-4-thiomorpholin-4-ylphenyl)urea |
| SMILES | Cc1cc(N2CCSCC2)ccc1NC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H21N3O3S/c1-13-10-15(22-6-8-26-9-7-22)3-4-16(13)21-19(23)20-14-2-5-17-18(11-14)25-12-24-17/h2-5,10-11H,6-9,12H2,1H3,(H2,20,21,23) |
| InChIKey | UXYZYOWOSHAUKM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|