C15H22O5 — CID 95790141
4-[(2S,3S)-2,3-dihydroxy-6-methylheptan-2-yl]-3-hydroxybenzoic acid (PubChem CID 95790141) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-[(2S,3S)-2,3-dihydroxy-6-methylheptan-2-yl]-3-hydroxybenzoic acid.
| Compound Name | 4-[(2S,3S)-2,3-dihydroxy-6-methylheptan-2-yl]-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 95790141 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 4-[(2S,3S)-2,3-dihydroxy-6-methylheptan-2-yl]-3-hydroxybenzoic acid |
| SMILES | CC(C)CC[C@H](O)[C@@](C)(O)c1ccc(C(=O)O)cc1O |
| InChI | InChI=1S/C15H22O5/c1-9(2)4-7-13(17)15(3,20)11-6-5-10(14(18)19)8-12(11)16/h5-6,8-9,13,16-17,20H,4,7H2,1-3H3,(H,18,19)/t13-,15-/m0/s1 |
| InChIKey | BEKGPVBOKXOKDT-ZFWWWQNUSA-N |
| XLogP | 2.10 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |