C21H24N2O2 — CID 95813138
(3R)-3-[[3-(4-methoxyphenyl)phenyl]methyl]-1-prop-2-enylpiperazin-2-one (PubChem CID 95813138) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is (3R)-3-[[3-(4-methoxyphenyl)phenyl]methyl]-1-prop-2-enylpiperazin-2-one.
| Compound Name | (3R)-3-[[3-(4-methoxyphenyl)phenyl]methyl]-1-prop-2-enylpiperazin-2-one |
|---|---|
| PubChem CID | 95813138 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (3R)-3-[[3-(4-methoxyphenyl)phenyl]methyl]-1-prop-2-enylpiperazin-2-one |
| SMILES | C=CCN1CCN[C@H](Cc2cccc(-c3ccc(OC)cc3)c2)C1=O |
| InChI | InChI=1S/C21H24N2O2/c1-3-12-23-13-11-22-20(21(23)24)15-16-5-4-6-18(14-16)17-7-9-19(25-2)10-8-17/h3-10,14,20,22H,1,11-13,15H2,2H3/t20-/m1/s1 |
| InChIKey | FHGSPWVHWOQDJX-HXUWFJFHSA-N |
| XLogP | 2.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|