C25H26N4O — CID 95820106
[4-[6-[(3R)-1-(1H-indol-5-ylmethyl)piperidin-3-yl]pyrazin-2-yl]phenyl]methanol (PubChem CID 95820106) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is [4-[6-[(3R)-1-(1H-indol-5-ylmethyl)piperidin-3-yl]pyrazin-2-yl]phenyl]methanol.
| Compound Name | [4-[6-[(3R)-1-(1H-indol-5-ylmethyl)piperidin-3-yl]pyrazin-2-yl]phenyl]methanol |
|---|---|
| PubChem CID | 95820106 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | [4-[6-[(3R)-1-(1H-indol-5-ylmethyl)piperidin-3-yl]pyrazin-2-yl]phenyl]methanol |
| SMILES | OCc1ccc(-c2cncc([C@@H]3CCCN(Cc4ccc5[nH]ccc5c4)C3)n2)cc1 |
| InChI | InChI=1S/C25H26N4O/c30-17-18-3-6-20(7-4-18)24-13-26-14-25(28-24)22-2-1-11-29(16-22)15-19-5-8-23-21(12-19)9-10-27-23/h3-10,12-14,22,27,30H,1-2,11,15-17H2/t22-/m1/s1 |
| InChIKey | MAHDIRSFGBEBMP-JOCHJYFZSA-N |
| XLogP | 4.50 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |