C11H17ClN4O2S — CID 95829502
(3R)-3-(3-chloropyrazin-2-yl)-N,N-dimethylpiperidine-1-sulfonamide (PubChem CID 95829502) has the molecular formula C11H17ClN4O2S and a molecular weight of 304.80 g/mol. Its IUPAC name is (3R)-3-(3-chloropyrazin-2-yl)-N,N-dimethylpiperidine-1-sulfonamide.
| Compound Name | (3R)-3-(3-chloropyrazin-2-yl)-N,N-dimethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 95829502 |
| Molecular Formula | C11H17ClN4O2S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | (3R)-3-(3-chloropyrazin-2-yl)-N,N-dimethylpiperidine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCC[C@@H](c2nccnc2Cl)C1 |
| InChI | InChI=1S/C11H17ClN4O2S/c1-15(2)19(17,18)16-7-3-4-9(8-16)10-11(12)14-6-5-13-10/h5-6,9H,3-4,7-8H2,1-2H3/t9-/m1/s1 |
| InChIKey | ZFADRZWMWYEFSV-SECBINFHSA-N |
| XLogP | 1.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |