C24H31N5O3 — CID 95834232
(4S)-1-(3-methoxypropyl)-4-[4-[5-(pyridin-2-ylamino)-2-pyridinyl]piperidine-1-carbonyl]pyrrolidin-2-one (PubChem CID 95834232) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is (4S)-1-(3-methoxypropyl)-4-[4-[5-(pyridin-2-ylamino)-2-pyridinyl]piperidine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | (4S)-1-(3-methoxypropyl)-4-[4-[5-(pyridin-2-ylamino)-2-pyridinyl]piperidine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 95834232 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | (4S)-1-(3-methoxypropyl)-4-[4-[5-(pyridin-2-ylamino)-2-pyridinyl]piperidine-1-carbonyl]pyrrolidin-2-one |
| SMILES | COCCCN1C[C@@H](C(=O)N2CCC(c3ccc(Nc4ccccn4)cn3)CC2)CC1=O |
| InChI | InChI=1S/C24H31N5O3/c1-32-14-4-11-29-17-19(15-23(29)30)24(31)28-12-8-18(9-13-28)21-7-6-20(16-26-21)27-22-5-2-3-10-25-22/h2-3,5-7,10,16,18-19H,4,8-9,11-15,17H2,1H3,(H,25,27)/t19-/m0/s1 |
| InChIKey | MPBUSUJHTHQRKY-IBGZPJMESA-N |
| XLogP | 2.81 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|