C18H17FN6O2S — CID 95837660
4-[(2S)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]-N-pyrimidin-5-ylpyrimidin-2-amine (PubChem CID 95837660) has the molecular formula C18H17FN6O2S and a molecular weight of 400.44 g/mol. Its IUPAC name is 4-[(2S)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]-N-pyrimidin-5-ylpyrimidin-2-amine.
| Compound Name | 4-[(2S)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]-N-pyrimidin-5-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 95837660 |
| Molecular Formula | C18H17FN6O2S |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 4-[(2S)-1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]-N-pyrimidin-5-ylpyrimidin-2-amine |
| SMILES | O=S(=O)(c1ccc(F)cc1)N1CCC[C@H]1c1ccnc(Nc2cncnc2)n1 |
| InChI | InChI=1S/C18H17FN6O2S/c19-13-3-5-15(6-4-13)28(26,27)25-9-1-2-17(25)16-7-8-22-18(24-16)23-14-10-20-12-21-11-14/h3-8,10-12,17H,1-2,9H2,(H,22,23,24)/t17-/m0/s1 |
| InChIKey | WKZQQSWKCWQGIA-KRWDZBQOSA-N |
| XLogP | 2.68 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |