C13H18N4O3 — CID 95841040
morpholin-4-yl-[(2R)-4-pyrimidin-5-ylmorpholin-2-yl]methanone (PubChem CID 95841040) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is morpholin-4-yl-[(2R)-4-pyrimidin-5-ylmorpholin-2-yl]methanone.
| Compound Name | morpholin-4-yl-[(2R)-4-pyrimidin-5-ylmorpholin-2-yl]methanone |
|---|---|
| PubChem CID | 95841040 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | morpholin-4-yl-[(2R)-4-pyrimidin-5-ylmorpholin-2-yl]methanone |
| SMILES | O=C([C@H]1CN(c2cncnc2)CCO1)N1CCOCC1 |
| InChI | InChI=1S/C13H18N4O3/c18-13(16-1-4-19-5-2-16)12-9-17(3-6-20-12)11-7-14-10-15-8-11/h7-8,10,12H,1-6,9H2/t12-/m1/s1 |
| InChIKey | OCCDVAWLJRAMDB-GFCCVEGCSA-N |
| XLogP | -0.46 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |