C12H13N5O2S — CID 127244733
4-pyrimidin-5-yl-N-(1,3-thiazol-2-yl)morpholine-2-carboxamide (PubChem CID 127244733) has the molecular formula C12H13N5O2S and a molecular weight of 291.34 g/mol. Its IUPAC name is 4-pyrimidin-5-yl-N-(1,3-thiazol-2-yl)morpholine-2-carboxamide.
| Compound Name | 4-pyrimidin-5-yl-N-(1,3-thiazol-2-yl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 127244733 |
| Molecular Formula | C12H13N5O2S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 4-pyrimidin-5-yl-N-(1,3-thiazol-2-yl)morpholine-2-carboxamide |
| SMILES | O=C(Nc1nccs1)C1CN(c2cncnc2)CCO1 |
| InChI | InChI=1S/C12H13N5O2S/c18-11(16-12-15-1-4-20-12)10-7-17(2-3-19-10)9-5-13-8-14-6-9/h1,4-6,8,10H,2-3,7H2,(H,15,16,18) |
| InChIKey | IEXMYFJCHNAEGA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |