C13H22N4O4S — CID 95847738
2-[methyl-[2-methyl-6-[(2R)-4-methylsulfonylmorpholin-2-yl]pyrimidin-4-yl]amino]ethanol (PubChem CID 95847738) has the molecular formula C13H22N4O4S and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-[methyl-[2-methyl-6-[(2R)-4-methylsulfonylmorpholin-2-yl]pyrimidin-4-yl]amino]ethanol.
| Compound Name | 2-[methyl-[2-methyl-6-[(2R)-4-methylsulfonylmorpholin-2-yl]pyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 95847738 |
| Molecular Formula | C13H22N4O4S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-[methyl-[2-methyl-6-[(2R)-4-methylsulfonylmorpholin-2-yl]pyrimidin-4-yl]amino]ethanol |
| SMILES | Cc1nc([C@H]2CN(S(C)(=O)=O)CCO2)cc(N(C)CCO)n1 |
| InChI | InChI=1S/C13H22N4O4S/c1-10-14-11(8-13(15-10)16(2)4-6-18)12-9-17(5-7-21-12)22(3,19)20/h8,12,18H,4-7,9H2,1-3H3/t12-/m1/s1 |
| InChIKey | CTUAYFVTWBSPCV-GFCCVEGCSA-N |
| XLogP | -0.45 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |