C18H24N4O2 — CID 95847602
6-[(2R)-4-(4-methoxyphenyl)morpholin-2-yl]-N,N,2-trimethylpyrimidin-4-amine (PubChem CID 95847602) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 6-[(2R)-4-(4-methoxyphenyl)morpholin-2-yl]-N,N,2-trimethylpyrimidin-4-amine.
| Compound Name | 6-[(2R)-4-(4-methoxyphenyl)morpholin-2-yl]-N,N,2-trimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 95847602 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 6-[(2R)-4-(4-methoxyphenyl)morpholin-2-yl]-N,N,2-trimethylpyrimidin-4-amine |
| SMILES | COc1ccc(N2CCO[C@@H](c3cc(N(C)C)nc(C)n3)C2)cc1 |
| InChI | InChI=1S/C18H24N4O2/c1-13-19-16(11-18(20-13)21(2)3)17-12-22(9-10-24-17)14-5-7-15(23-4)8-6-14/h5-8,11,17H,9-10,12H2,1-4H3/t17-/m1/s1 |
| InChIKey | PPJCBZPXJQCPRX-QGZVFWFLSA-N |
| XLogP | 2.44 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|