C12H16N4O3S — CID 95857382
4-methoxy-N-[(2S)-2-(1,2,4-triazol-1-yl)propyl]benzenesulfonamide (PubChem CID 95857382) has the molecular formula C12H16N4O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is 4-methoxy-N-[(2S)-2-(1,2,4-triazol-1-yl)propyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[(2S)-2-(1,2,4-triazol-1-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 95857382 |
| Molecular Formula | C12H16N4O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 4-methoxy-N-[(2S)-2-(1,2,4-triazol-1-yl)propyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC[C@H](C)n2cncn2)cc1 |
| InChI | InChI=1S/C12H16N4O3S/c1-10(16-9-13-8-14-16)7-15-20(17,18)12-5-3-11(19-2)4-6-12/h3-6,8-10,15H,7H2,1-2H3/t10-/m0/s1 |
| InChIKey | AKAXVAVMYYGEQE-JTQLQIEISA-N |
| XLogP | 0.83 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |