C16H17Cl2N3O2S — CID 95859796
2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-2-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 95859796) has the molecular formula C16H17Cl2N3O2S and a molecular weight of 386.30 g/mol. Its IUPAC name is 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-2-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-2-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 95859796 |
| Molecular Formula | C16H17Cl2N3O2S |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-2-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | Cc1nnc(NC(=O)C(C)(C)Oc2ccc([C@@H]3CC3(Cl)Cl)cc2)s1 |
| InChI | InChI=1S/C16H17Cl2N3O2S/c1-9-20-21-14(24-9)19-13(22)15(2,3)23-11-6-4-10(5-7-11)12-8-16(12,17)18/h4-7,12H,8H2,1-3H3,(H,19,21,22)/t12-/m0/s1 |
| InChIKey | YKRMAUDBCQHZBR-LBPRGKRZSA-N |
| XLogP | 4.30 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|