About methyl 2-[[2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoyl]amino]-3-methylbutanoate
methyl 2-[[2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoyl]amino]-3-methylbutanoate (PubChem CID 91820901) has the molecular formula C19H25Cl2NO4
and a molecular weight of 402.32 g/mol. Its IUPAC name is methyl 2-[[2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoyl]amino]-3-methylbutanoate.
Molecular Properties
| Compound Name | methyl 2-[[2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoyl]amino]-3-methylbutanoate |
| PubChem CID | 91820901 |
| Molecular Formula | C19H25Cl2NO4 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | methyl 2-[[2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)C(NC(=O)C(C)(C)Oc1ccc(C2CC2(Cl)Cl)cc1)C(C)C |
| InChI | InChI=1S/C19H25Cl2NO4/c1-11(2)15(16(23)25-5)22-17(24)18(3,4)26-13-8-6-12(7-9-13)14-10-19(14,20)21/h6-9,11,14-15H,10H2,1-5H3,(H,22,24) |
| InChIKey | UQMYCQOKWIYTOK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[[2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoyl]amino]-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoyl]amino]-3-methylbutanoate?
The IUPAC name of methyl 2-[[2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoyl]amino]-3-methylbutanoate (CID 91820901) is methyl 2-[[2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoyl]amino]-3-methylbutanoate.
What is the SMILES notation for methyl 2-[[2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoyl]amino]-3-methylbutanoate?
The canonical SMILES for methyl 2-[[2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoyl]amino]-3-methylbutanoate is COC(=O)C(NC(=O)C(C)(C)Oc1ccc(C2CC2(Cl)Cl)cc1)C(C)C.
What is the InChIKey of methyl 2-[[2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoyl]amino]-3-methylbutanoate?
The InChIKey is UQMYCQOKWIYTOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25Cl2NO4/c1-11(2)15(16(23)25-5)22-17(24)18(3,4)26-13-8-6-12(7-9-13)14-10-19(14,20)21/h6-9,11,14-15H,10H2,1-5H3,(H,22,24).
What are the key properties of methyl 2-[[2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoyl]amino]-3-methylbutanoate?
methyl 2-[[2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoyl]amino]-3-methylbutanoate has a molecular weight of 402.32 g/mol, XLogP of 3.82, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoyl]amino]-3-methylbutanoate is sourced from PubChem (CID 91820901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).