C17H21Cl2NO4S — CID 96557259
2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-methylpropanamide (PubChem CID 96557259) has the molecular formula C17H21Cl2NO4S and a molecular weight of 406.33 g/mol. Its IUPAC name is 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-methylpropanamide.
| Compound Name | 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 96557259 |
| Molecular Formula | C17H21Cl2NO4S |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-[(3S)-1,1-dioxothiolan-3-yl]-2-methylpropanamide |
| SMILES | CC(C)(Oc1ccc([C@@H]2CC2(Cl)Cl)cc1)C(=O)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H21Cl2NO4S/c1-16(2,15(21)20-12-7-8-25(22,23)10-12)24-13-5-3-11(4-6-13)14-9-17(14,18)19/h3-6,12,14H,7-10H2,1-2H3,(H,20,21)/t12-,14-/m0/s1 |
| InChIKey | DLXSZWUIRBHYJU-JSGCOSHPSA-N |
| XLogP | 2.81 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|