About 2-[4-[(1R)-2,2-dichlorocyclopropyl]phenoxy]-2-methyl-N-prop-2-enylpropanamide
2-[4-[(1R)-2,2-dichlorocyclopropyl]phenoxy]-2-methyl-N-prop-2-enylpropanamide (PubChem CID 95389332) has the molecular formula C16H19Cl2NO2
and a molecular weight of 328.24 g/mol. Its IUPAC name is 2-[4-[(1R)-2,2-dichlorocyclopropyl]phenoxy]-2-methyl-N-prop-2-enylpropanamide.
Molecular Properties
| Compound Name | 2-[4-[(1R)-2,2-dichlorocyclopropyl]phenoxy]-2-methyl-N-prop-2-enylpropanamide |
| PubChem CID | 95389332 |
| Molecular Formula | C16H19Cl2NO2 |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-[4-[(1R)-2,2-dichlorocyclopropyl]phenoxy]-2-methyl-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)(C)Oc1ccc([C@H]2CC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H19Cl2NO2/c1-4-9-19-14(20)15(2,3)21-12-7-5-11(6-8-12)13-10-16(13,17)18/h4-8,13H,1,9-10H2,2-3H3,(H,19,20)/t13-/m1/s1 |
| InChIKey | XXDLWGOKQMCIMM-CYBMUJFWSA-N |
| XLogP | 3.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(1R)-2,2-dichlorocyclopropyl]phenoxy]-2-methyl-N-prop-2-enylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(1R)-2,2-dichlorocyclopropyl]phenoxy]-2-methyl-N-prop-2-enylpropanamide?
The IUPAC name of 2-[4-[(1R)-2,2-dichlorocyclopropyl]phenoxy]-2-methyl-N-prop-2-enylpropanamide (CID 95389332) is 2-[4-[(1R)-2,2-dichlorocyclopropyl]phenoxy]-2-methyl-N-prop-2-enylpropanamide.
What is the SMILES notation for 2-[4-[(1R)-2,2-dichlorocyclopropyl]phenoxy]-2-methyl-N-prop-2-enylpropanamide?
The canonical SMILES for 2-[4-[(1R)-2,2-dichlorocyclopropyl]phenoxy]-2-methyl-N-prop-2-enylpropanamide is C=CCNC(=O)C(C)(C)Oc1ccc([C@H]2CC2(Cl)Cl)cc1.
What is the InChIKey of 2-[4-[(1R)-2,2-dichlorocyclopropyl]phenoxy]-2-methyl-N-prop-2-enylpropanamide?
The InChIKey is XXDLWGOKQMCIMM-CYBMUJFWSA-N. The full InChI is InChI=1S/C16H19Cl2NO2/c1-4-9-19-14(20)15(2,3)21-12-7-5-11(6-8-12)13-10-16(13,17)18/h4-8,13H,1,9-10H2,2-3H3,(H,19,20)/t13-/m1/s1.
What are the key properties of 2-[4-[(1R)-2,2-dichlorocyclopropyl]phenoxy]-2-methyl-N-prop-2-enylpropanamide?
2-[4-[(1R)-2,2-dichlorocyclopropyl]phenoxy]-2-methyl-N-prop-2-enylpropanamide has a molecular weight of 328.24 g/mol, XLogP of 3.81, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(1R)-2,2-dichlorocyclopropyl]phenoxy]-2-methyl-N-prop-2-enylpropanamide is sourced from PubChem (CID 95389332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).