About 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-(2-imidazol-1-ylethyl)-2-methylpropanamide
2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-(2-imidazol-1-ylethyl)-2-methylpropanamide (PubChem CID 124879616) has the molecular formula C18H21Cl2N3O2
and a molecular weight of 382.29 g/mol. Its IUPAC name is 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-(2-imidazol-1-ylethyl)-2-methylpropanamide.
Molecular Properties
| Compound Name | 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-(2-imidazol-1-ylethyl)-2-methylpropanamide |
| PubChem CID | 124879616 |
| Molecular Formula | C18H21Cl2N3O2 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-(2-imidazol-1-ylethyl)-2-methylpropanamide |
| SMILES | CC(C)(Oc1ccc([C@@H]2CC2(Cl)Cl)cc1)C(=O)NCCn1ccnc1 |
| InChI | InChI=1S/C18H21Cl2N3O2/c1-17(2,16(24)22-8-10-23-9-7-21-12-23)25-14-5-3-13(4-6-14)15-11-18(15,19)20/h3-7,9,12,15H,8,10-11H2,1-2H3,(H,22,24)/t15-/m0/s1 |
| InChIKey | UWXLUNSWXISJEV-HNNXBMFYSA-N |
| XLogP | 3.52 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-(2-imidazol-1-ylethyl)-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-(2-imidazol-1-ylethyl)-2-methylpropanamide?
The IUPAC name of 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-(2-imidazol-1-ylethyl)-2-methylpropanamide (CID 124879616) is 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-(2-imidazol-1-ylethyl)-2-methylpropanamide.
What is the SMILES notation for 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-(2-imidazol-1-ylethyl)-2-methylpropanamide?
The canonical SMILES for 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-(2-imidazol-1-ylethyl)-2-methylpropanamide is CC(C)(Oc1ccc([C@@H]2CC2(Cl)Cl)cc1)C(=O)NCCn1ccnc1.
What is the InChIKey of 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-(2-imidazol-1-ylethyl)-2-methylpropanamide?
The InChIKey is UWXLUNSWXISJEV-HNNXBMFYSA-N. The full InChI is InChI=1S/C18H21Cl2N3O2/c1-17(2,16(24)22-8-10-23-9-7-21-12-23)25-14-5-3-13(4-6-14)15-11-18(15,19)20/h3-7,9,12,15H,8,10-11H2,1-2H3,(H,22,24)/t15-/m0/s1.
What are the key properties of 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-(2-imidazol-1-ylethyl)-2-methylpropanamide?
2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-(2-imidazol-1-ylethyl)-2-methylpropanamide has a molecular weight of 382.29 g/mol, XLogP of 3.52, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-(2-imidazol-1-ylethyl)-2-methylpropanamide is sourced from PubChem (CID 124879616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).