C18H21Cl2N3O2 — CID 124879616
2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-(2-imidazol-1-ylethyl)-2-methylpropanamide (PubChem CID 124879616) has the molecular formula C18H21Cl2N3O2 and a molecular weight of 382.29 g/mol. Its IUPAC name is 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-(2-imidazol-1-ylethyl)-2-methylpropanamide.
| Compound Name | 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-(2-imidazol-1-ylethyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 124879616 |
| Molecular Formula | C18H21Cl2N3O2 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-(2-imidazol-1-ylethyl)-2-methylpropanamide |
| SMILES | CC(C)(Oc1ccc([C@@H]2CC2(Cl)Cl)cc1)C(=O)NCCn1ccnc1 |
| InChI | InChI=1S/C18H21Cl2N3O2/c1-17(2,16(24)22-8-10-23-9-7-21-12-23)25-14-5-3-13(4-6-14)15-11-18(15,19)20/h3-7,9,12,15H,8,10-11H2,1-2H3,(H,22,24)/t15-/m0/s1 |
| InChIKey | UWXLUNSWXISJEV-HNNXBMFYSA-N |
| XLogP | 3.52 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|