C16H21Cl2NO3 — CID 95859194
2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-(2-methoxyethyl)-2-methylpropanamide (PubChem CID 95859194) has the molecular formula C16H21Cl2NO3 and a molecular weight of 346.25 g/mol. Its IUPAC name is 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-(2-methoxyethyl)-2-methylpropanamide.
| Compound Name | 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-(2-methoxyethyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 95859194 |
| Molecular Formula | C16H21Cl2NO3 |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2-[4-[(1S)-2,2-dichlorocyclopropyl]phenoxy]-N-(2-methoxyethyl)-2-methylpropanamide |
| SMILES | COCCNC(=O)C(C)(C)Oc1ccc([C@@H]2CC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H21Cl2NO3/c1-15(2,14(20)19-8-9-21-3)22-12-6-4-11(5-7-12)13-10-16(13,17)18/h4-7,13H,8-10H2,1-3H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | CGNLSQCFDMTZBN-ZDUSSCGKSA-N |
| XLogP | 3.27 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|