C21H22Cl2O5 — CID 141447370
2-(3,4-dihydroxyphenyl)ethyl 2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoate (PubChem CID 141447370) has the molecular formula C21H22Cl2O5 and a molecular weight of 425.31 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)ethyl 2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoate.
| Compound Name | 2-(3,4-dihydroxyphenyl)ethyl 2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 141447370 |
| Molecular Formula | C21H22Cl2O5 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)ethyl 2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoate |
| SMILES | CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)OCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H22Cl2O5/c1-20(2,19(26)27-10-9-13-3-8-17(24)18(25)11-13)28-15-6-4-14(5-7-15)16-12-21(16,22)23/h3-8,11,16,24-25H,9-10,12H2,1-2H3 |
| InChIKey | LQRZEFJSTNHJNY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|