C23H25N3O — CID 95871055
(3R)-3-methyl-4-[[7-methyl-2-(3-methylphenyl)quinolin-3-yl]methyl]piperazin-2-one (PubChem CID 95871055) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is (3R)-3-methyl-4-[[7-methyl-2-(3-methylphenyl)quinolin-3-yl]methyl]piperazin-2-one.
| Compound Name | (3R)-3-methyl-4-[[7-methyl-2-(3-methylphenyl)quinolin-3-yl]methyl]piperazin-2-one |
|---|---|
| PubChem CID | 95871055 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | (3R)-3-methyl-4-[[7-methyl-2-(3-methylphenyl)quinolin-3-yl]methyl]piperazin-2-one |
| SMILES | Cc1cccc(-c2nc3cc(C)ccc3cc2CN2CCNC(=O)[C@H]2C)c1 |
| InChI | InChI=1S/C23H25N3O/c1-15-5-4-6-19(11-15)22-20(14-26-10-9-24-23(27)17(26)3)13-18-8-7-16(2)12-21(18)25-22/h4-8,11-13,17H,9-10,14H2,1-3H3,(H,24,27)/t17-/m1/s1 |
| InChIKey | CBECBNDZKLSBTE-QGZVFWFLSA-N |
| XLogP | 3.84 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |