C18H21N3O2 — CID 95875413
[(2S)-2-methylpiperidin-1-yl]-[4-(6-methylpyridazin-3-yl)oxyphenyl]methanone (PubChem CID 95875413) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is [(2S)-2-methylpiperidin-1-yl]-[4-(6-methylpyridazin-3-yl)oxyphenyl]methanone.
| Compound Name | [(2S)-2-methylpiperidin-1-yl]-[4-(6-methylpyridazin-3-yl)oxyphenyl]methanone |
|---|---|
| PubChem CID | 95875413 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | [(2S)-2-methylpiperidin-1-yl]-[4-(6-methylpyridazin-3-yl)oxyphenyl]methanone |
| SMILES | Cc1ccc(Oc2ccc(C(=O)N3CCCC[C@@H]3C)cc2)nn1 |
| InChI | InChI=1S/C18H21N3O2/c1-13-6-11-17(20-19-13)23-16-9-7-15(8-10-16)18(22)21-12-4-3-5-14(21)2/h6-11,14H,3-5,12H2,1-2H3/t14-/m0/s1 |
| InChIKey | LVZGGDPYOUEHFT-AWEZNQCLSA-N |
| XLogP | 3.59 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |