C20H33N3O2 — CID 95894412
(3S)-N-[3-(furan-2-yl)propyl]-8-methyl-2-propyl-2,8-diazaspiro[4.5]decane-3-carboxamide (PubChem CID 95894412) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is (3S)-N-[3-(furan-2-yl)propyl]-8-methyl-2-propyl-2,8-diazaspiro[4.5]decane-3-carboxamide.
| Compound Name | (3S)-N-[3-(furan-2-yl)propyl]-8-methyl-2-propyl-2,8-diazaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 95894412 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | (3S)-N-[3-(furan-2-yl)propyl]-8-methyl-2-propyl-2,8-diazaspiro[4.5]decane-3-carboxamide |
| SMILES | CCCN1CC2(CCN(C)CC2)C[C@H]1C(=O)NCCCc1ccco1 |
| InChI | InChI=1S/C20H33N3O2/c1-3-11-23-16-20(8-12-22(2)13-9-20)15-18(23)19(24)21-10-4-6-17-7-5-14-25-17/h5,7,14,18H,3-4,6,8-13,15-16H2,1-2H3,(H,21,24)/t18-/m0/s1 |
| InChIKey | VDGJCMGCTSDLKF-SFHVURJKSA-N |
| XLogP | 2.52 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|