C13H17N3O4 — CID 74250472
N-[3-(furan-2-yl)propyl]-2,7-dioxo-1,3-diazepane-4-carboxamide (PubChem CID 74250472) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is N-[3-(furan-2-yl)propyl]-2,7-dioxo-1,3-diazepane-4-carboxamide.
| Compound Name | N-[3-(furan-2-yl)propyl]-2,7-dioxo-1,3-diazepane-4-carboxamide |
|---|---|
| PubChem CID | 74250472 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-[3-(furan-2-yl)propyl]-2,7-dioxo-1,3-diazepane-4-carboxamide |
| SMILES | O=C1CCC(C(=O)NCCCc2ccco2)NC(=O)N1 |
| InChI | InChI=1S/C13H17N3O4/c17-11-6-5-10(15-13(19)16-11)12(18)14-7-1-3-9-4-2-8-20-9/h2,4,8,10H,1,3,5-7H2,(H,14,18)(H2,15,16,17,19) |
| InChIKey | BILPUZUESKXVRO-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|