C17H20N4O3S — CID 95901219
2-[(3S)-3-[(1-methylpyrazol-4-yl)methyl]-2,5-dioxopyrrolidin-1-yl]-N-(2-thiophen-3-ylethyl)acetamide (PubChem CID 95901219) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-[(3S)-3-[(1-methylpyrazol-4-yl)methyl]-2,5-dioxopyrrolidin-1-yl]-N-(2-thiophen-3-ylethyl)acetamide.
| Compound Name | 2-[(3S)-3-[(1-methylpyrazol-4-yl)methyl]-2,5-dioxopyrrolidin-1-yl]-N-(2-thiophen-3-ylethyl)acetamide |
|---|---|
| PubChem CID | 95901219 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-[(3S)-3-[(1-methylpyrazol-4-yl)methyl]-2,5-dioxopyrrolidin-1-yl]-N-(2-thiophen-3-ylethyl)acetamide |
| SMILES | Cn1cc(C[C@H]2CC(=O)N(CC(=O)NCCc3ccsc3)C2=O)cn1 |
| InChI | InChI=1S/C17H20N4O3S/c1-20-9-13(8-19-20)6-14-7-16(23)21(17(14)24)10-15(22)18-4-2-12-3-5-25-11-12/h3,5,8-9,11,14H,2,4,6-7,10H2,1H3,(H,18,22)/t14-/m0/s1 |
| InChIKey | VGKSXWBQWZJKIN-AWEZNQCLSA-N |
| XLogP | 0.76 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|