C15H17N3O3S — CID 95903262
N-(furan-2-ylmethyl)-2-[(2S)-3-oxo-2-thiophen-2-ylpiperazin-1-yl]acetamide (PubChem CID 95903262) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[(2S)-3-oxo-2-thiophen-2-ylpiperazin-1-yl]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[(2S)-3-oxo-2-thiophen-2-ylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 95903262 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[(2S)-3-oxo-2-thiophen-2-ylpiperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCNC(=O)[C@H]1c1cccs1)NCc1ccco1 |
| InChI | InChI=1S/C15H17N3O3S/c19-13(17-9-11-3-1-7-21-11)10-18-6-5-16-15(20)14(18)12-4-2-8-22-12/h1-4,7-8,14H,5-6,9-10H2,(H,16,20)(H,17,19)/t14-/m1/s1 |
| InChIKey | RAMIDHDKCIQBID-CQSZACIVSA-N |
| XLogP | 1.13 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |