About (5-chlorofuran-2-yl)-[4-[(5S)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]piperazin-1-yl]methanone
(5-chlorofuran-2-yl)-[4-[(5S)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]piperazin-1-yl]methanone (PubChem CID 95905591) has the molecular formula C13H16ClN3O2S
and a molecular weight of 313.81 g/mol. Its IUPAC name is (5-chlorofuran-2-yl)-[4-[(5S)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]piperazin-1-yl]methanone.
Molecular Properties
| Compound Name | (5-chlorofuran-2-yl)-[4-[(5S)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]piperazin-1-yl]methanone |
| PubChem CID | 95905591 |
| Molecular Formula | C13H16ClN3O2S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | (5-chlorofuran-2-yl)-[4-[(5S)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]piperazin-1-yl]methanone |
| SMILES | C[C@H]1CN=C(N2CCN(C(=O)c3ccc(Cl)o3)CC2)S1 |
| InChI | InChI=1S/C13H16ClN3O2S/c1-9-8-15-13(20-9)17-6-4-16(5-7-17)12(18)10-2-3-11(14)19-10/h2-3,9H,4-8H2,1H3/t9-/m0/s1 |
| InChIKey | GQTKAHBLQJRBKI-VIFPVBQESA-N |
| XLogP | 2.18 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-chlorofuran-2-yl)-[4-[(5S)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]piperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chlorofuran-2-yl)-[4-[(5S)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]piperazin-1-yl]methanone?
The IUPAC name of (5-chlorofuran-2-yl)-[4-[(5S)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]piperazin-1-yl]methanone (CID 95905591) is (5-chlorofuran-2-yl)-[4-[(5S)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]piperazin-1-yl]methanone.
What is the SMILES notation for (5-chlorofuran-2-yl)-[4-[(5S)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]piperazin-1-yl]methanone?
The canonical SMILES for (5-chlorofuran-2-yl)-[4-[(5S)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]piperazin-1-yl]methanone is C[C@H]1CN=C(N2CCN(C(=O)c3ccc(Cl)o3)CC2)S1.
What is the InChIKey of (5-chlorofuran-2-yl)-[4-[(5S)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]piperazin-1-yl]methanone?
The InChIKey is GQTKAHBLQJRBKI-VIFPVBQESA-N. The full InChI is InChI=1S/C13H16ClN3O2S/c1-9-8-15-13(20-9)17-6-4-16(5-7-17)12(18)10-2-3-11(14)19-10/h2-3,9H,4-8H2,1H3/t9-/m0/s1.
What are the key properties of (5-chlorofuran-2-yl)-[4-[(5S)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]piperazin-1-yl]methanone?
(5-chlorofuran-2-yl)-[4-[(5S)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]piperazin-1-yl]methanone has a molecular weight of 313.81 g/mol, XLogP of 2.18, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chlorofuran-2-yl)-[4-[(5S)-5-methyl-4,5-dihydro-1,3-thiazol-2-yl]piperazin-1-yl]methanone is sourced from PubChem (CID 95905591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).