C14H18N2O3S — CID 95905607
(2R)-N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-2-thiophen-2-ylpropanamide (PubChem CID 95905607) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is (2R)-N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-2-thiophen-2-ylpropanamide.
| Compound Name | (2R)-N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-2-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 95905607 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (2R)-N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-2-thiophen-2-ylpropanamide |
| SMILES | C[C@H](C(=O)NCCN1C(=O)CCCC1=O)c1cccs1 |
| InChI | InChI=1S/C14H18N2O3S/c1-10(11-4-3-9-20-11)14(19)15-7-8-16-12(17)5-2-6-13(16)18/h3-4,9-10H,2,5-8H2,1H3,(H,15,19)/t10-/m0/s1 |
| InChIKey | NWZOBGDCYDHGPP-JTQLQIEISA-N |
| XLogP | 1.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|