C21H30N2O3 — CID 166182165
N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-4-[4-(2-methylpropyl)phenyl]butanamide (PubChem CID 166182165) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-4-[4-(2-methylpropyl)phenyl]butanamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-4-[4-(2-methylpropyl)phenyl]butanamide |
|---|---|
| PubChem CID | 166182165 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-4-[4-(2-methylpropyl)phenyl]butanamide |
| SMILES | CC(C)Cc1ccc(CCCC(=O)NCCN2C(=O)CCCC2=O)cc1 |
| InChI | InChI=1S/C21H30N2O3/c1-16(2)15-18-11-9-17(10-12-18)5-3-6-19(24)22-13-14-23-20(25)7-4-8-21(23)26/h9-12,16H,3-8,13-15H2,1-2H3,(H,22,24) |
| InChIKey | QILZMKVNKSQCPT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|