C27H36N4O5 — CID 95909184
benzyl (2S)-2-[[(1S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-pyridin-2-ylbutyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 95909184) has the molecular formula C27H36N4O5 and a molecular weight of 496.61 g/mol. Its IUPAC name is benzyl (2S)-2-[[(1S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-pyridin-2-ylbutyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-[[(1S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-pyridin-2-ylbutyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 95909184 |
| Molecular Formula | C27H36N4O5 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | benzyl (2S)-2-[[(1S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-pyridin-2-ylbutyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)NCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)OCc1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C27H36N4O5/c1-27(2,3)36-25(33)29-17-9-14-22(21-13-7-8-16-28-21)30-24(32)23-15-10-18-31(23)26(34)35-19-20-11-5-4-6-12-20/h4-8,11-13,16,22-23H,9-10,14-15,17-19H2,1-3H3,(H,29,33)(H,30,32)/t22-,23-/m0/s1 |
| InChIKey | IXYYCYGMYFOPNT-GOTSBHOMSA-N |
| XLogP | 4.34 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|