C17H12ClNO2S — CID 95909677
prop-2-enyl 2-(4-chlorophenyl)-1,3-benzothiazole-6-carboxylate (PubChem CID 95909677) has the molecular formula C17H12ClNO2S and a molecular weight of 329.81 g/mol. Its IUPAC name is prop-2-enyl 2-(4-chlorophenyl)-1,3-benzothiazole-6-carboxylate.
| Compound Name | prop-2-enyl 2-(4-chlorophenyl)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 95909677 |
| Molecular Formula | C17H12ClNO2S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | prop-2-enyl 2-(4-chlorophenyl)-1,3-benzothiazole-6-carboxylate |
| SMILES | C=CCOC(=O)c1ccc2nc(-c3ccc(Cl)cc3)sc2c1 |
| InChI | InChI=1S/C17H12ClNO2S/c1-2-9-21-17(20)12-5-8-14-15(10-12)22-16(19-14)11-3-6-13(18)7-4-11/h2-8,10H,1,9H2 |
| InChIKey | LKHBBJSBWSLBFH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|